C12H14O5 — CID 11322357
[(4S,6S,7R,8S,11S)-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-8-yl] acetate (PubChem CID 11322357) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is [(4S,6S,7R,8S,11S)-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-8-yl] acetate.
| Compound Name | [(4S,6S,7R,8S,11S)-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-8-yl] acetate |
|---|---|
| PubChem CID | 11322357 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(4S,6S,7R,8S,11S)-6-methyl-2-oxo-3,9-dioxatricyclo[5.3.1.04,11]undec-1(10)-en-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC=C2C(=O)O[C@H]3C[C@H](C)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C12H14O5/c1-5-3-8-10-7(11(14)17-8)4-15-12(9(5)10)16-6(2)13/h4-5,8-10,12H,3H2,1-2H3/t5-,8-,9+,10-,12-/m0/s1 |
| InChIKey | JKTDNLYPEAHCEE-XNTHYFLOSA-N |
| XLogP | 0.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |