C18H24N4OS — CID 113223941
N'-benzyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine (PubChem CID 113223941) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N'-benzyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine.
| Compound Name | N'-benzyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 113223941 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N'-benzyl-N-[(6-methoxyimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-N'-methylpropane-1,3-diamine |
| SMILES | COc1nc2sccn2c1CNCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N4OS/c1-21(14-15-7-4-3-5-8-15)10-6-9-19-13-16-17(23-2)20-18-22(16)11-12-24-18/h3-5,7-8,11-12,19H,6,9-10,13-14H2,1-2H3 |
| InChIKey | GOKNWMVTMZDTEC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|