C10H16F3N3O — CID 113224215
1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113224215) has the molecular formula C10H16F3N3O and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113224215 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NC1CCN2CCCC12 |
| InChI | InChI=1S/C10H16F3N3O/c11-10(12,13)6-14-9(17)15-7-3-5-16-4-1-2-8(7)16/h7-8H,1-6H2,(H2,14,15,17) |
| InChIKey | LXFALRZHOGYJAL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |