C13H12N4S — CID 113224886
N-[(1-phenylpyrazol-3-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 113224886) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-[(1-phenylpyrazol-3-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(1-phenylpyrazol-3-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 113224886 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-[(1-phenylpyrazol-3-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | c1ccc(-n2ccc(CNc3nccs3)n2)cc1 |
| InChI | InChI=1S/C13H12N4S/c1-2-4-12(5-3-1)17-8-6-11(16-17)10-15-13-14-7-9-18-13/h1-9H,10H2,(H,14,15) |
| InChIKey | WWLGQLWBAOIENC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |