C17H23F3N2O — CID 113225311
N-[3-[(2-cyclohexylethylamino)methyl]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 113225311) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is N-[3-[(2-cyclohexylethylamino)methyl]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(2-cyclohexylethylamino)methyl]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 113225311 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[3-[(2-cyclohexylethylamino)methyl]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cccc(CNCCC2CCCCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C17H23F3N2O/c18-17(19,20)16(23)22-15-8-4-7-14(11-15)12-21-10-9-13-5-2-1-3-6-13/h4,7-8,11,13,21H,1-3,5-6,9-10,12H2,(H,22,23) |
| InChIKey | HWDGYNLGCLOTFR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|