C15H19NO2 — CID 11322544
(4S)-2-[(2S,3R)-2-methyl-3-phenyloxiran-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 11322544) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (4S)-2-[(2S,3R)-2-methyl-3-phenyloxiran-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[(2S,3R)-2-methyl-3-phenyloxiran-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11322544 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (4S)-2-[(2S,3R)-2-methyl-3-phenyloxiran-2-yl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@H]1COC([C@@]2(C)O[C@@H]2c2ccccc2)=N1 |
| InChI | InChI=1S/C15H19NO2/c1-10(2)12-9-17-14(16-12)15(3)13(18-15)11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3/t12-,13-,15+/m1/s1 |
| InChIKey | JOTFYLNHOWGOPS-NFAWXSAZSA-N |
| XLogP | 2.97 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|