C11H20F3N3O — CID 113225924
1-(2-piperidin-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 113225924) has the molecular formula C11H20F3N3O and a molecular weight of 267.29 g/mol. Its IUPAC name is 1-(2-piperidin-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-piperidin-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 113225924 |
| Molecular Formula | C11H20F3N3O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-(2-piperidin-1-ylpropyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(CNC(=O)NCC(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C11H20F3N3O/c1-9(17-5-3-2-4-6-17)7-15-10(18)16-8-11(12,13)14/h9H,2-8H2,1H3,(H2,15,16,18) |
| InChIKey | GERDCZNUYISWIW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |