C14H18O4 — CID 11322662
3,3,5,5,7,7-hexamethyl-2-benzofuran-1,4,6-trione (PubChem CID 11322662) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3,3,5,5,7,7-hexamethyl-2-benzofuran-1,4,6-trione.
| Compound Name | 3,3,5,5,7,7-hexamethyl-2-benzofuran-1,4,6-trione |
|---|---|
| PubChem CID | 11322662 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3,3,5,5,7,7-hexamethyl-2-benzofuran-1,4,6-trione |
| SMILES | CC1(C)OC(=O)C2=C1C(=O)C(C)(C)C(=O)C2(C)C |
| InChI | InChI=1S/C14H18O4/c1-12(2)8-7(14(5,6)18-10(8)16)9(15)13(3,4)11(12)17/h1-6H3 |
| InChIKey | LXSTYKIHKQHKSU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|