About 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde
8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde (PubChem CID 11322692) has the molecular formula C15H9NO3
and a molecular weight of 251.24 g/mol. Its IUPAC name is 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde |
| PubChem CID | 11322692 |
| Molecular Formula | C15H9NO3 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde |
| SMILES | O=Cc1cc2c3ccc(O)cc3[nH]c2c2ccoc12 |
| InChI | InChI=1S/C15H9NO3/c17-7-8-5-12-10-2-1-9(18)6-13(10)16-14(12)11-3-4-19-15(8)11/h1-7,16,18H |
| InChIKey | YBJULDBBRCYNQP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde?
The IUPAC name of 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde (CID 11322692) is 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde.
What is the SMILES notation for 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde?
The canonical SMILES for 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde is O=Cc1cc2c3ccc(O)cc3[nH]c2c2ccoc12.
What is the InChIKey of 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde?
The InChIKey is YBJULDBBRCYNQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9NO3/c17-7-8-5-12-10-2-1-9(18)6-13(10)16-14(12)11-3-4-19-15(8)11/h1-7,16,18H.
What are the key properties of 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde?
8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde has a molecular weight of 251.24 g/mol, XLogP of 3.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-10H-furo[3,2-a]carbazole-4-carbaldehyde is sourced from PubChem (CID 11322692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).