About 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine
2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine (PubChem CID 11322699) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine.
Molecular Properties
| Compound Name | 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine |
| PubChem CID | 11322699 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine |
| SMILES | Cc1cccc(C#CCOc2cccc(C)c2C)n1 |
| InChI | InChI=1S/C17H17NO/c1-13-7-4-11-17(15(13)3)19-12-6-10-16-9-5-8-14(2)18-16/h4-5,7-9,11H,12H2,1-3H3 |
| InChIKey | FFUFEORCKIBCBY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine?
The IUPAC name of 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine (CID 11322699) is 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine.
What is the SMILES notation for 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine?
The canonical SMILES for 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine is Cc1cccc(C#CCOc2cccc(C)c2C)n1.
What is the InChIKey of 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine?
The InChIKey is FFUFEORCKIBCBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO/c1-13-7-4-11-17(15(13)3)19-12-6-10-16-9-5-8-14(2)18-16/h4-5,7-9,11H,12H2,1-3H3.
What are the key properties of 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine?
2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine has a molecular weight of 251.33 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,3-dimethylphenoxy)prop-1-ynyl]-6-methylpyridine is sourced from PubChem (CID 11322699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).