C15H24O3 — CID 11322725
(1aS,2aR,5R,5aR,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-1a,2,3,4,5a,7-hexahydroazuleno[6,7-b]oxiren-6-one (PubChem CID 11322725) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1aS,2aR,5R,5aR,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-1a,2,3,4,5a,7-hexahydroazuleno[6,7-b]oxiren-6-one.
| Compound Name | (1aS,2aR,5R,5aR,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-1a,2,3,4,5a,7-hexahydroazuleno[6,7-b]oxiren-6-one |
|---|---|
| PubChem CID | 11322725 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1aS,2aR,5R,5aR,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-1a,2,3,4,5a,7-hexahydroazuleno[6,7-b]oxiren-6-one |
| SMILES | CC(C)[C@]1(O)CC[C@]2(C)C[C@@H]3O[C@]3(C)CC(=O)[C@H]21 |
| InChI | InChI=1S/C15H24O3/c1-9(2)15(17)6-5-13(3)8-11-14(4,18-11)7-10(16)12(13)15/h9,11-12,17H,5-8H2,1-4H3/t11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | ISSIBRVEWKOYFA-NJVJYBDUSA-N |
| XLogP | 2.31 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|