C15H28OSi — CID 11322735
tert-butyl-dimethyl-[(1S)-1-prop-2-enylcyclohex-3-en-1-yl]oxysilane (PubChem CID 11322735) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-1-prop-2-enylcyclohex-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S)-1-prop-2-enylcyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11322735 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-1-prop-2-enylcyclohex-3-en-1-yl]oxysilane |
| SMILES | C=CC[C@]1(O[Si](C)(C)C(C)(C)C)CC=CCC1 |
| InChI | InChI=1S/C15H28OSi/c1-7-11-15(12-9-8-10-13-15)16-17(5,6)14(2,3)4/h7-9H,1,10-13H2,2-6H3/t15-/m0/s1 |
| InChIKey | HPTWOROYCCHKBS-HNNXBMFYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|