About 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide
5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide (PubChem CID 11322754) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide.
Molecular Properties
| Compound Name | 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide |
| PubChem CID | 11322754 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide |
| SMILES | C=CCCC(CCCC(=O)N(C)C)C(C)(O)C=C |
| InChI | InChI=1S/C15H27NO2/c1-6-8-10-13(15(3,18)7-2)11-9-12-14(17)16(4)5/h6-7,13,18H,1-2,8-12H2,3-5H3 |
| InChIKey | KYTHGXKZCHAMRJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide?
The IUPAC name of 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide (CID 11322754) is 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide.
What is the SMILES notation for 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide?
The canonical SMILES for 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide is C=CCCC(CCCC(=O)N(C)C)C(C)(O)C=C.
What is the InChIKey of 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide?
The InChIKey is KYTHGXKZCHAMRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-6-8-10-13(15(3,18)7-2)11-9-12-14(17)16(4)5/h6-7,13,18H,1-2,8-12H2,3-5H3.
What are the key properties of 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide?
5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide has a molecular weight of 253.39 g/mol, XLogP of 2.76, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxybut-3-en-2-yl)-N,N-dimethylnon-8-enamide is sourced from PubChem (CID 11322754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).