C14H18Cl2N2O — CID 113228627
2,6-dichloro-N-cyclopropyl-N-(3-methylbutyl)pyridine-3-carboxamide (PubChem CID 113228627) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 2,6-dichloro-N-cyclopropyl-N-(3-methylbutyl)pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-cyclopropyl-N-(3-methylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113228627 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2,6-dichloro-N-cyclopropyl-N-(3-methylbutyl)pyridine-3-carboxamide |
| SMILES | CC(C)CCN(C(=O)c1ccc(Cl)nc1Cl)C1CC1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9(2)7-8-18(10-3-4-10)14(19)11-5-6-12(15)17-13(11)16/h5-6,9-10H,3-4,7-8H2,1-2H3 |
| InChIKey | VOODJNUWVHYYHV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|