About 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate
3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate (PubChem CID 11322866) has the molecular formula C13H22O5
and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate.
Molecular Properties
| Compound Name | 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate |
| PubChem CID | 11322866 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate |
| SMILES | CC(=O)OCCC[C@H]1C[C@@H](COC(C)=O)[C@@]1(C)O |
| InChI | InChI=1S/C13H22O5/c1-9(14)17-6-4-5-11-7-12(13(11,3)16)8-18-10(2)15/h11-12,16H,4-8H2,1-3H3/t11-,12-,13-/m0/s1 |
| InChIKey | ZTJFVOWSLZEMDR-AVGNSLFASA-N |
| XLogP | 1.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate?
The IUPAC name of 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate (CID 11322866) is 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate.
What is the SMILES notation for 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate?
The canonical SMILES for 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate is CC(=O)OCCC[C@H]1C[C@@H](COC(C)=O)[C@@]1(C)O.
What is the InChIKey of 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate?
The InChIKey is ZTJFVOWSLZEMDR-AVGNSLFASA-N. The full InChI is InChI=1S/C13H22O5/c1-9(14)17-6-4-5-11-7-12(13(11,3)16)8-18-10(2)15/h11-12,16H,4-8H2,1-3H3/t11-,12-,13-/m0/s1.
What are the key properties of 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate?
3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate has a molecular weight of 258.31 g/mol, XLogP of 1.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2S,3S)-3-(acetyloxymethyl)-2-hydroxy-2-methylcyclobutyl]propyl acetate is sourced from PubChem (CID 11322866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).