C21H23N3 — CID 113228770
3-benzyl-2-cyclopropyl-5-(2,4-dimethylphenyl)imidazol-4-amine (PubChem CID 113228770) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is 3-benzyl-2-cyclopropyl-5-(2,4-dimethylphenyl)imidazol-4-amine.
| Compound Name | 3-benzyl-2-cyclopropyl-5-(2,4-dimethylphenyl)imidazol-4-amine |
|---|---|
| PubChem CID | 113228770 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3-benzyl-2-cyclopropyl-5-(2,4-dimethylphenyl)imidazol-4-amine |
| SMILES | Cc1ccc(-c2nc(C3CC3)n(Cc3ccccc3)c2N)c(C)c1 |
| InChI | InChI=1S/C21H23N3/c1-14-8-11-18(15(2)12-14)19-20(22)24(21(23-19)17-9-10-17)13-16-6-4-3-5-7-16/h3-8,11-12,17H,9-10,13,22H2,1-2H3 |
| InChIKey | GEWQKKKGZITWCE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |