C13H16N4 — CID 113228940
3-N-methyl-3-N-(2-phenylethyl)pyrazine-2,3-diamine (PubChem CID 113228940) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-N-methyl-3-N-(2-phenylethyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-methyl-3-N-(2-phenylethyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 113228940 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-N-methyl-3-N-(2-phenylethyl)pyrazine-2,3-diamine |
| SMILES | CN(CCc1ccccc1)c1nccnc1N |
| InChI | InChI=1S/C13H16N4/c1-17(13-12(14)15-8-9-16-13)10-7-11-5-3-2-4-6-11/h2-6,8-9H,7,10H2,1H3,(H2,14,15) |
| InChIKey | HFYANYAYSNWVON-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |