C10H15NO5S — CID 11322957
(4R)-4-[(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-oxazolidine-2-thione (PubChem CID 11322957) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (4R)-4-[(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-oxazolidine-2-thione.
| Compound Name | (4R)-4-[(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 11322957 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (4R)-4-[(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-oxazolidine-2-thione |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(=S)N3)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C10H15NO5S/c1-10(2)15-7-5(12)6(14-8(7)16-10)4-3-13-9(17)11-4/h4-8,12H,3H2,1-2H3,(H,11,17)/t4-,5-,6-,7-,8-/m1/s1 |
| InChIKey | UHGDJZKZYLCYTO-FMDGEEDCSA-N |
| XLogP | -0.50 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|