C12H14BrN3O2 — CID 113229764
2-bromo-6-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]phenol (PubChem CID 113229764) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-bromo-6-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]phenol.
| Compound Name | 2-bromo-6-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 113229764 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-bromo-6-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethylamino]methyl]phenol |
| SMILES | Cc1nc(CCNCc2cccc(Br)c2O)no1 |
| InChI | InChI=1S/C12H14BrN3O2/c1-8-15-11(16-18-8)5-6-14-7-9-3-2-4-10(13)12(9)17/h2-4,14,17H,5-7H2,1H3 |
| InChIKey | BLPYOBJHRDCHIO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|