C8H11IO2 — CID 11323077
(1R,2R,4S,5S)-4-iodo-2-methyl-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 11323077) has the molecular formula C8H11IO2 and a molecular weight of 266.08 g/mol. Its IUPAC name is (1R,2R,4S,5S)-4-iodo-2-methyl-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (1R,2R,4S,5S)-4-iodo-2-methyl-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 11323077 |
| Molecular Formula | C8H11IO2 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | (1R,2R,4S,5S)-4-iodo-2-methyl-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | C[C@@H]1C[C@H](I)[C@@H]2C[C@H]1C(=O)O2 |
| InChI | InChI=1S/C8H11IO2/c1-4-2-6(9)7-3-5(4)8(10)11-7/h4-7H,2-3H2,1H3/t4-,5-,6+,7+/m1/s1 |
| InChIKey | ZVHBATFZGOEACL-JWXFUTCRSA-N |
| XLogP | 1.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|