About [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene
[3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene (PubChem CID 11323131) has the molecular formula C17H17OP
and a molecular weight of 268.30 g/mol. Its IUPAC name is [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene.
Molecular Properties
| Compound Name | [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene |
| PubChem CID | 11323131 |
| Molecular Formula | C17H17OP |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene |
| SMILES | CC(C)=C=CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17OP/c1-15(2)13-14-19(18,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14H,1-2H3 |
| InChIKey | SOHAHIARUKKVEP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene?
The IUPAC name of [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene (CID 11323131) is [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene.
What is the SMILES notation for [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene?
The canonical SMILES for [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene is CC(C)=C=CP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene?
The InChIKey is SOHAHIARUKKVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17OP/c1-15(2)13-14-19(18,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14H,1-2H3.
What are the key properties of [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene?
[3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene has a molecular weight of 268.30 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methylbuta-1,2-dienyl(phenyl)phosphoryl]benzene is sourced from PubChem (CID 11323131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).