C14H22O5 — CID 11323185
[(1S,2R,4S,5R,6S,7S)-6-hydroxy-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dimethylpropanoate (PubChem CID 11323185) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6S,7S)-6-hydroxy-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,2R,4S,5R,6S,7S)-6-hydroxy-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11323185 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [(1S,2R,4S,5R,6S,7S)-6-hydroxy-1,5-dimethyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C[C@]2(C)O[C@](C)([C@H]1O)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C14H22O5/c1-12(2,3)11(16)17-7-6-13(4)9-10(18-9)14(5,19-13)8(7)15/h7-10,15H,6H2,1-5H3/t7-,8-,9+,10-,13-,14+/m0/s1 |
| InChIKey | CXMSNEHOXZMRCB-PMDHNFMNSA-N |
| XLogP | 1.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|