About N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide
N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide (PubChem CID 113232085) has the molecular formula C11H15N3O2S2
and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide |
| PubChem CID | 113232085 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCNc1snc2ccccc12 |
| InChI | InChI=1S/C11H15N3O2S2/c1-18(15,16)13-8-4-7-12-11-9-5-2-3-6-10(9)14-17-11/h2-3,5-6,12-13H,4,7-8H2,1H3 |
| InChIKey | TVIRTZMPUOJYTG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide?
The IUPAC name of N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide (CID 113232085) is N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide.
What is the SMILES notation for N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide?
The canonical SMILES for N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide is CS(=O)(=O)NCCCNc1snc2ccccc12.
What is the InChIKey of N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide?
The InChIKey is TVIRTZMPUOJYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O2S2/c1-18(15,16)13-8-4-7-12-11-9-5-2-3-6-10(9)14-17-11/h2-3,5-6,12-13H,4,7-8H2,1H3.
What are the key properties of N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide?
N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide has a molecular weight of 285.39 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,1-benzothiazol-3-ylamino)propyl]methanesulfonamide is sourced from PubChem (CID 113232085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).