C20H40N2O2 — CID 113232684
tert-butyl 3-[1-(octan-2-ylamino)ethyl]piperidine-1-carboxylate (PubChem CID 113232684) has the molecular formula C20H40N2O2 and a molecular weight of 340.55 g/mol. Its IUPAC name is tert-butyl 3-[1-(octan-2-ylamino)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(octan-2-ylamino)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113232684 |
| Molecular Formula | C20H40N2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | tert-butyl 3-[1-(octan-2-ylamino)ethyl]piperidine-1-carboxylate |
| SMILES | CCCCCCC(C)NC(C)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H40N2O2/c1-7-8-9-10-12-16(2)21-17(3)18-13-11-14-22(15-18)19(23)24-20(4,5)6/h16-18,21H,7-15H2,1-6H3 |
| InChIKey | JGMKVTVBQLIBKW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|