C15H14BF4KO — CID 113233035
potassium trifluoro-[5-fluoro-2-(3-phenylpropoxy)phenyl]boranuide (PubChem CID 113233035) has the molecular formula C15H14BF4KO and a molecular weight of 336.18 g/mol. Its IUPAC name is potassium trifluoro-[5-fluoro-2-(3-phenylpropoxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[5-fluoro-2-(3-phenylpropoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 113233035 |
| Molecular Formula | C15H14BF4KO |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | potassium trifluoro-[5-fluoro-2-(3-phenylpropoxy)phenyl]boranuide |
| SMILES | Fc1ccc(OCCCc2ccccc2)c([B-](F)(F)F)c1.[K+] |
| InChI | InChI=1S/C15H14BF4O.K/c17-13-8-9-15(14(11-13)16(18,19)20)21-10-4-7-12-5-2-1-3-6-12;/h1-3,5-6,8-9,11H,4,7,10H2;/q-1;+1 |
| InChIKey | UZEXFRPKRHKCEM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|