C17H22O3 — CID 11323312
ethyl (1R,5S,7R)-12-ethenyl-10-oxotricyclo[5.3.2.01,5]dodec-8-ene-9-carboxylate (PubChem CID 11323312) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl (1R,5S,7R)-12-ethenyl-10-oxotricyclo[5.3.2.01,5]dodec-8-ene-9-carboxylate.
| Compound Name | ethyl (1R,5S,7R)-12-ethenyl-10-oxotricyclo[5.3.2.01,5]dodec-8-ene-9-carboxylate |
|---|---|
| PubChem CID | 11323312 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | ethyl (1R,5S,7R)-12-ethenyl-10-oxotricyclo[5.3.2.01,5]dodec-8-ene-9-carboxylate |
| SMILES | C=CC1C[C@]23CCC[C@H]2C[C@H]1C=C(C(=O)OCC)C3=O |
| InChI | InChI=1S/C17H22O3/c1-3-11-10-17-7-5-6-13(17)8-12(11)9-14(15(17)18)16(19)20-4-2/h3,9,11-13H,1,4-8,10H2,2H3/t11?,12-,13-,17+/m0/s1 |
| InChIKey | XRWZDCJQPMLKFM-WLRYYPKHSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|