C18H26O2 — CID 11323315
(3Z)-3-ethenyl-5-methoxy-4,8,11,11-tetramethylbicyclo[5.3.1]undeca-3,7-dien-2-one (PubChem CID 11323315) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (3Z)-3-ethenyl-5-methoxy-4,8,11,11-tetramethylbicyclo[5.3.1]undeca-3,7-dien-2-one.
| Compound Name | (3Z)-3-ethenyl-5-methoxy-4,8,11,11-tetramethylbicyclo[5.3.1]undeca-3,7-dien-2-one |
|---|---|
| PubChem CID | 11323315 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (3Z)-3-ethenyl-5-methoxy-4,8,11,11-tetramethylbicyclo[5.3.1]undeca-3,7-dien-2-one |
| SMILES | C=C/C1=C(\C)C(OC)CC2=C(C)CCC(C1=O)C2(C)C |
| InChI | InChI=1S/C18H26O2/c1-7-13-12(3)16(20-6)10-15-11(2)8-9-14(17(13)19)18(15,4)5/h7,14,16H,1,8-10H2,2-6H3/b13-12- |
| InChIKey | HTVGOAZSCYVEIS-SEYXRHQNSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|