C13H16F3NO2 — CID 11323329
1-[(4R)-4-(cyanomethyl)-5,5-dimethylcyclopenten-1-yl]ethyl 2,2,2-trifluoroacetate (PubChem CID 11323329) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 1-[(4R)-4-(cyanomethyl)-5,5-dimethylcyclopenten-1-yl]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 1-[(4R)-4-(cyanomethyl)-5,5-dimethylcyclopenten-1-yl]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11323329 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-[(4R)-4-(cyanomethyl)-5,5-dimethylcyclopenten-1-yl]ethyl 2,2,2-trifluoroacetate |
| SMILES | CC(OC(=O)C(F)(F)F)C1=CC[C@H](CC#N)C1(C)C |
| InChI | InChI=1S/C13H16F3NO2/c1-8(19-11(18)13(14,15)16)10-5-4-9(6-7-17)12(10,2)3/h5,8-9H,4,6H2,1-3H3/t8?,9-/m1/s1 |
| InChIKey | RIEBVANYQWRAQF-YGPZHTELSA-N |
| XLogP | 3.37 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|