C14H22N2O2 — CID 113233571
1,1-diethyl-3-[(2-methoxyphenyl)methyl]-3-methylurea (PubChem CID 113233571) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,1-diethyl-3-[(2-methoxyphenyl)methyl]-3-methylurea.
| Compound Name | 1,1-diethyl-3-[(2-methoxyphenyl)methyl]-3-methylurea |
|---|---|
| PubChem CID | 113233571 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1,1-diethyl-3-[(2-methoxyphenyl)methyl]-3-methylurea |
| SMILES | CCN(CC)C(=O)N(C)Cc1ccccc1OC |
| InChI | InChI=1S/C14H22N2O2/c1-5-16(6-2)14(17)15(3)11-12-9-7-8-10-13(12)18-4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | DYAPCNHCIDKQAX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |