C14H15N3O — CID 113233887
4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]benzonitrile (PubChem CID 113233887) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]benzonitrile.
| Compound Name | 4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 113233887 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-[(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl]benzonitrile |
| SMILES | CC(C)(C)c1noc(Cc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C14H15N3O/c1-14(2,3)13-16-12(18-17-13)8-10-4-6-11(9-15)7-5-10/h4-7H,8H2,1-3H3 |
| InChIKey | MXXGTMMISQXPLQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |