C15H22N2 — CID 113234819
N-(1H-indol-7-ylmethyl)-3,3-dimethylbutan-2-amine (PubChem CID 113234819) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-(1H-indol-7-ylmethyl)-3,3-dimethylbutan-2-amine.
| Compound Name | N-(1H-indol-7-ylmethyl)-3,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 113234819 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N-(1H-indol-7-ylmethyl)-3,3-dimethylbutan-2-amine |
| SMILES | CC(NCc1cccc2cc[nH]c12)C(C)(C)C |
| InChI | InChI=1S/C15H22N2/c1-11(15(2,3)4)17-10-13-7-5-6-12-8-9-16-14(12)13/h5-9,11,16-17H,10H2,1-4H3 |
| InChIKey | GDWMXRYPMQFIMS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |