About 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile
4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile (PubChem CID 11323483) has the molecular formula C14H7N3O4
and a molecular weight of 281.23 g/mol. Its IUPAC name is 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile |
| PubChem CID | 11323483 |
| Molecular Formula | C14H7N3O4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(-n2oc3cc([N+](=O)[O-])ccc3c2=O)cc1 |
| InChI | InChI=1S/C14H7N3O4/c15-8-9-1-3-10(4-2-9)16-14(18)12-6-5-11(17(19)20)7-13(12)21-16/h1-7H |
| InChIKey | MHJTXFUZIIOYGZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 102.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile?
The IUPAC name of 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile (CID 11323483) is 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile.
What is the SMILES notation for 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile?
The canonical SMILES for 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile is N#Cc1ccc(-n2oc3cc([N+](=O)[O-])ccc3c2=O)cc1.
What is the InChIKey of 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile?
The InChIKey is MHJTXFUZIIOYGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7N3O4/c15-8-9-1-3-10(4-2-9)16-14(18)12-6-5-11(17(19)20)7-13(12)21-16/h1-7H.
What are the key properties of 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile?
4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile has a molecular weight of 281.23 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-nitro-3-oxo-1,2-benzoxazol-2-yl)benzonitrile is sourced from PubChem (CID 11323483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).