C13H26N2O3 — CID 113235636
tert-butyl 2-[(4-ethylmorpholin-2-yl)methylamino]acetate (PubChem CID 113235636) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is tert-butyl 2-[(4-ethylmorpholin-2-yl)methylamino]acetate.
| Compound Name | tert-butyl 2-[(4-ethylmorpholin-2-yl)methylamino]acetate |
|---|---|
| PubChem CID | 113235636 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | tert-butyl 2-[(4-ethylmorpholin-2-yl)methylamino]acetate |
| SMILES | CCN1CCOC(CNCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H26N2O3/c1-5-15-6-7-17-11(10-15)8-14-9-12(16)18-13(2,3)4/h11,14H,5-10H2,1-4H3 |
| InChIKey | TYFQDFUHBUUCAV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |