C28H36N2O5S — CID 113236052
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfanyl]butanoic acid (PubChem CID 113236052) has the molecular formula C28H36N2O5S and a molecular weight of 512.67 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfanyl]butanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 113236052 |
| Molecular Formula | C28H36N2O5S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[[4-(2-methylpropyl)morpholin-2-yl]methylsulfanyl]butanoic acid |
| SMILES | CC(C)CN1CCOC(CSCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)C1 |
| InChI | InChI=1S/C28H36N2O5S/c1-19(2)15-30-12-13-34-20(16-30)18-36-14-11-26(27(31)32)29-28(33)35-17-25-23-9-5-3-7-21(23)22-8-4-6-10-24(22)25/h3-10,19-20,25-26H,11-18H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | FZICDQXJVRYSNK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|