About 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide
4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide (PubChem CID 113236671) has the molecular formula C12H21F3N2O
and a molecular weight of 266.31 g/mol. Its IUPAC name is 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide.
Molecular Properties
| Compound Name | 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide |
| PubChem CID | 113236671 |
| Molecular Formula | C12H21F3N2O |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide |
| SMILES | CC(C)C1CCCN(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H21F3N2O/c1-9(2)10-4-3-6-17(7-5-10)11(18)16-8-12(13,14)15/h9-10H,3-8H2,1-2H3,(H,16,18) |
| InChIKey | VMUZZWUBBRMSIB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide?
The IUPAC name of 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide (CID 113236671) is 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide.
What is the SMILES notation for 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide?
The canonical SMILES for 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide is CC(C)C1CCCN(C(=O)NCC(F)(F)F)CC1.
What is the InChIKey of 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide?
The InChIKey is VMUZZWUBBRMSIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O/c1-9(2)10-4-3-6-17(7-5-10)11(18)16-8-12(13,14)15/h9-10H,3-8H2,1-2H3,(H,16,18).
What are the key properties of 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide?
4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide has a molecular weight of 266.31 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-N-(2,2,2-trifluoroethyl)azepane-1-carboxamide is sourced from PubChem (CID 113236671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).