About potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide
potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide (PubChem CID 113236838) has the molecular formula C16H15BF3KO2
and a molecular weight of 346.20 g/mol. Its IUPAC name is potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide.
Molecular Properties
| Compound Name | potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide |
| PubChem CID | 113236838 |
| Molecular Formula | C16H15BF3KO2 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)c1cccc(OCC2OCCc3ccccc32)c1.[K+] |
| InChI | InChI=1S/C16H15BF3O2.K/c18-17(19,20)13-5-3-6-14(10-13)22-11-16-15-7-2-1-4-12(15)8-9-21-16;/h1-7,10,16H,8-9,11H2;/q-1;+1 |
| InChIKey | KHGADOUDBPUSLG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide?
The IUPAC name of potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide (CID 113236838) is potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide.
What is the SMILES notation for potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide?
The canonical SMILES for potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide is F[B-](F)(F)c1cccc(OCC2OCCc3ccccc32)c1.[K+].
What is the InChIKey of potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide?
The InChIKey is KHGADOUDBPUSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BF3O2.K/c18-17(19,20)13-5-3-6-14(10-13)22-11-16-15-7-2-1-4-12(15)8-9-21-16;/h1-7,10,16H,8-9,11H2;/q-1;+1.
What are the key properties of potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide?
potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide has a molecular weight of 346.20 g/mol, XLogP of 0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide is sourced from PubChem (CID 113236838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).