C16H15BF3KO2 — CID 113236838
potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide (PubChem CID 113236838) has the molecular formula C16H15BF3KO2 and a molecular weight of 346.20 g/mol. Its IUPAC name is potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide.
| Compound Name | potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 113236838 |
| Molecular Formula | C16H15BF3KO2 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | potassium [3-(3,4-dihydro-1H-isochromen-1-ylmethoxy)phenyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)c1cccc(OCC2OCCc3ccccc32)c1.[K+] |
| InChI | InChI=1S/C16H15BF3O2.K/c18-17(19,20)13-5-3-6-14(10-13)22-11-16-15-7-2-1-4-12(15)8-9-21-16;/h1-7,10,16H,8-9,11H2;/q-1;+1 |
| InChIKey | KHGADOUDBPUSLG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|