About 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride
2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride (PubChem CID 11323710) has the molecular formula C11H26Cl2N2O2
and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride |
| PubChem CID | 11323710 |
| Molecular Formula | C11H26Cl2N2O2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride |
| SMILES | C[N+]1(CCOCCOCCN)CCCC1.Cl.[Cl-] |
| InChI | InChI=1S/C11H25N2O2.2ClH/c1-13(5-2-3-6-13)7-9-15-11-10-14-8-4-12;;/h2-12H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | UICJOJRMIKPVSM-UHFFFAOYSA-M |
| XLogP | -2.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride?
The IUPAC name of 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride (CID 11323710) is 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride.
What is the SMILES notation for 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride?
The canonical SMILES for 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride is C[N+]1(CCOCCOCCN)CCCC1.Cl.[Cl-].
What is the InChIKey of 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride?
The InChIKey is UICJOJRMIKPVSM-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H25N2O2.2ClH/c1-13(5-2-3-6-13)7-9-15-11-10-14-8-4-12;;/h2-12H2,1H3;2*1H/q+1;;/p-1.
What are the key properties of 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride?
2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride has a molecular weight of 289.25 g/mol, XLogP of -2.36, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]ethoxy]ethanamine;chloride;hydrochloride is sourced from PubChem (CID 11323710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).