C13H10Br2FNOS — CID 113237232
2,5-dibromo-N-[1-(4-fluorophenyl)ethyl]thiophene-3-carboxamide (PubChem CID 113237232) has the molecular formula C13H10Br2FNOS and a molecular weight of 407.10 g/mol. Its IUPAC name is 2,5-dibromo-N-[1-(4-fluorophenyl)ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[1-(4-fluorophenyl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 113237232 |
| Molecular Formula | C13H10Br2FNOS |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 404.88 |
| IUPAC Name | 2,5-dibromo-N-[1-(4-fluorophenyl)ethyl]thiophene-3-carboxamide |
| SMILES | CC(NC(=O)c1cc(Br)sc1Br)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10Br2FNOS/c1-7(8-2-4-9(16)5-3-8)17-13(18)10-6-11(14)19-12(10)15/h2-7H,1H3,(H,17,18) |
| InChIKey | ZBFCNXBVNBSNAU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |