C18H30OSi — CID 11323745
tert-butyl-[(1S,5S)-3-ethynyl-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 11323745) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is tert-butyl-[(1S,5S)-3-ethynyl-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1S,5S)-3-ethynyl-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11323745 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | tert-butyl-[(1S,5S)-3-ethynyl-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C#CC1=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C(=C)C)C1 |
| InChI | InChI=1S/C18H30OSi/c1-10-15-11-16(13(2)3)12-17(14(15)4)19-20(8,9)18(5,6)7/h1,16-17H,2,11-12H2,3-9H3/t16-,17-/m0/s1 |
| InChIKey | DLOKYKQIWLTNAV-IRXDYDNUSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|