About 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine
4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine (PubChem CID 113238157) has the molecular formula C11H15ClN2O2S2
and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine |
| PubChem CID | 113238157 |
| Molecular Formula | C11H15ClN2O2S2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(S(=O)(=O)c2ccc(Cl)nc2)C1C |
| InChI | InChI=1S/C11H15ClN2O2S2/c1-8-9(2)17-6-5-14(8)18(15,16)10-3-4-11(12)13-7-10/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | FHDMITFXSJKYSF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine?
The IUPAC name of 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine (CID 113238157) is 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine.
What is the SMILES notation for 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine?
The canonical SMILES for 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine is CC1SCCN(S(=O)(=O)c2ccc(Cl)nc2)C1C.
What is the InChIKey of 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine?
The InChIKey is FHDMITFXSJKYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O2S2/c1-8-9(2)17-6-5-14(8)18(15,16)10-3-4-11(12)13-7-10/h3-4,7-9H,5-6H2,1-2H3.
What are the key properties of 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine?
4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine has a molecular weight of 306.84 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine is sourced from PubChem (CID 113238157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).