C15H28N2O — CID 113239651
1,1-diethyl-3-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)urea (PubChem CID 113239651) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,1-diethyl-3-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)urea.
| Compound Name | 1,1-diethyl-3-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)urea |
|---|---|
| PubChem CID | 113239651 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1,1-diethyl-3-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)urea |
| SMILES | CCN(CC)C(=O)NC1C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C15H28N2O/c1-6-17(7-2)13(18)16-12-14(3,4)11-8-9-15(12,5)10-11/h11-12H,6-10H2,1-5H3,(H,16,18) |
| InChIKey | LKIVSRHVPNSWFC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |