C12H21N3O2 — CID 113239797
1-N-cyclobutyl-3-N-methylpiperidine-1,3-dicarboxamide (PubChem CID 113239797) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1-N-cyclobutyl-3-N-methylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-cyclobutyl-3-N-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 113239797 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 1-N-cyclobutyl-3-N-methylpiperidine-1,3-dicarboxamide |
| SMILES | CNC(=O)C1CCCN(C(=O)NC2CCC2)C1 |
| InChI | InChI=1S/C12H21N3O2/c1-13-11(16)9-4-3-7-15(8-9)12(17)14-10-5-2-6-10/h9-10H,2-8H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | YHQYYLFGSICBSW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |