C19H23BrN2O2S — CID 113241829
N-benzyl-2-bromo-4-[(cyclopropylamino)methyl]-N-ethylbenzenesulfonamide (PubChem CID 113241829) has the molecular formula C19H23BrN2O2S and a molecular weight of 423.38 g/mol. Its IUPAC name is N-benzyl-2-bromo-4-[(cyclopropylamino)methyl]-N-ethylbenzenesulfonamide.
| Compound Name | N-benzyl-2-bromo-4-[(cyclopropylamino)methyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113241829 |
| Molecular Formula | C19H23BrN2O2S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-benzyl-2-bromo-4-[(cyclopropylamino)methyl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1ccc(CNC2CC2)cc1Br |
| InChI | InChI=1S/C19H23BrN2O2S/c1-2-22(14-15-6-4-3-5-7-15)25(23,24)19-11-8-16(12-18(19)20)13-21-17-9-10-17/h3-8,11-12,17,21H,2,9-10,13-14H2,1H3 |
| InChIKey | RFPGHLQLFDHQBZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |