C21H34N2O — CID 113242310
2-[benzyl-[[1-[(cyclopropylamino)methyl]-4-methylcyclohexyl]methyl]amino]ethanol (PubChem CID 113242310) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 2-[benzyl-[[1-[(cyclopropylamino)methyl]-4-methylcyclohexyl]methyl]amino]ethanol.
| Compound Name | 2-[benzyl-[[1-[(cyclopropylamino)methyl]-4-methylcyclohexyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 113242310 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 2-[benzyl-[[1-[(cyclopropylamino)methyl]-4-methylcyclohexyl]methyl]amino]ethanol |
| SMILES | CC1CCC(CNC2CC2)(CN(CCO)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H34N2O/c1-18-9-11-21(12-10-18,16-22-20-7-8-20)17-23(13-14-24)15-19-5-3-2-4-6-19/h2-6,18,20,22,24H,7-17H2,1H3 |
| InChIKey | JXQPIMITZRGPND-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |