C13H15Cl3O2 — CID 11324334
(4S,5S)-2,2-dimethyl-4-phenyl-5-(2,2,2-trichloroethyl)-1,3-dioxolane (PubChem CID 11324334) has the molecular formula C13H15Cl3O2 and a molecular weight of 309.62 g/mol. Its IUPAC name is (4S,5S)-2,2-dimethyl-4-phenyl-5-(2,2,2-trichloroethyl)-1,3-dioxolane.
| Compound Name | (4S,5S)-2,2-dimethyl-4-phenyl-5-(2,2,2-trichloroethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 11324334 |
| Molecular Formula | C13H15Cl3O2 |
| Molecular Weight | 309.62 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | (4S,5S)-2,2-dimethyl-4-phenyl-5-(2,2,2-trichloroethyl)-1,3-dioxolane |
| SMILES | CC1(C)O[C@@H](CC(Cl)(Cl)Cl)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H15Cl3O2/c1-12(2)17-10(8-13(14,15)16)11(18-12)9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | DBVGNGWVYJJALU-QWRGUYRKSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|