C14H20BrFN2O — CID 113244838
3-bromo-N-[1-(diethylamino)propan-2-yl]-4-fluorobenzamide (PubChem CID 113244838) has the molecular formula C14H20BrFN2O and a molecular weight of 331.23 g/mol. Its IUPAC name is 3-bromo-N-[1-(diethylamino)propan-2-yl]-4-fluorobenzamide.
| Compound Name | 3-bromo-N-[1-(diethylamino)propan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 113244838 |
| Molecular Formula | C14H20BrFN2O |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 3-bromo-N-[1-(diethylamino)propan-2-yl]-4-fluorobenzamide |
| SMILES | CCN(CC)CC(C)NC(=O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H20BrFN2O/c1-4-18(5-2)9-10(3)17-14(19)11-6-7-13(16)12(15)8-11/h6-8,10H,4-5,9H2,1-3H3,(H,17,19) |
| InChIKey | VFSXDYQUWDBVBJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |