C20H29NO2 — CID 11324519
[(2S,4aS,7R,8aR)-3-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone (PubChem CID 11324519) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [(2S,4aS,7R,8aR)-3-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone.
| Compound Name | [(2S,4aS,7R,8aR)-3-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11324519 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | [(2S,4aS,7R,8aR)-3-ethyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone |
| SMILES | CCN1[C@H](C(=O)c2ccccc2)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C20H29NO2/c1-5-21-19(18(22)15-9-7-6-8-10-15)23-17-13-14(2)11-12-16(17)20(21,3)4/h6-10,14,16-17,19H,5,11-13H2,1-4H3/t14-,16-,17-,19+/m1/s1 |
| InChIKey | HABNSPLCHPMUBN-MYZZLAAOSA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |