C18H33N3O3 — CID 113246591
tert-butyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)piperidine-1-carboxylate (PubChem CID 113246591) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is tert-butyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 113246591 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | tert-butyl 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCC2CN3CCCC3CO2)CC1 |
| InChI | InChI=1S/C18H33N3O3/c1-18(2,3)24-17(22)20-9-6-14(7-10-20)19-11-16-12-21-8-4-5-15(21)13-23-16/h14-16,19H,4-13H2,1-3H3 |
| InChIKey | BRKJEPKXVBKWHV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |