C17H23NO3S — CID 11324712
(3R,4S,5S)-4-hydroxy-5-phenylsulfanyl-3-[(2R)-piperidin-2-yl]oxepan-2-one (PubChem CID 11324712) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (3R,4S,5S)-4-hydroxy-5-phenylsulfanyl-3-[(2R)-piperidin-2-yl]oxepan-2-one.
| Compound Name | (3R,4S,5S)-4-hydroxy-5-phenylsulfanyl-3-[(2R)-piperidin-2-yl]oxepan-2-one |
|---|---|
| PubChem CID | 11324712 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3R,4S,5S)-4-hydroxy-5-phenylsulfanyl-3-[(2R)-piperidin-2-yl]oxepan-2-one |
| SMILES | O=C1OCC[C@H](Sc2ccccc2)[C@@H](O)[C@H]1[C@H]1CCCCN1 |
| InChI | InChI=1S/C17H23NO3S/c19-16-14(22-12-6-2-1-3-7-12)9-11-21-17(20)15(16)13-8-4-5-10-18-13/h1-3,6-7,13-16,18-19H,4-5,8-11H2/t13-,14+,15-,16-/m1/s1 |
| InChIKey | VAKHXKAPQSGFEZ-QKPAOTATSA-N |
| XLogP | 2.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |