C22H27NO — CID 11324714
N-benzyl-N-(2,2-dimethyl-7-phenylhept-4-yn-3-yl)hydroxylamine (PubChem CID 11324714) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is N-benzyl-N-(2,2-dimethyl-7-phenylhept-4-yn-3-yl)hydroxylamine.
| Compound Name | N-benzyl-N-(2,2-dimethyl-7-phenylhept-4-yn-3-yl)hydroxylamine |
|---|---|
| PubChem CID | 11324714 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-benzyl-N-(2,2-dimethyl-7-phenylhept-4-yn-3-yl)hydroxylamine |
| SMILES | CC(C)(C)C(C#CCCc1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C22H27NO/c1-22(2,3)21(23(24)18-20-15-8-5-9-16-20)17-11-10-14-19-12-6-4-7-13-19/h4-9,12-13,15-16,21,24H,10,14,18H2,1-3H3 |
| InChIKey | TYSHIKOHQLGDAX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|